lyabeatrice
lyabeatrice lyabeatrice
  • 03-04-2022
  • Geography
contestada

How has Hungary's history helped set it apart from other countries in inland Eastern Europe?​

Respuesta :

rodriguezroy921 rodriguezroy921
  • 04-04-2022

Answer: Hungary's history helped set it apart from other countries in Eastern europe by siding with germany in world war 1.  Meanwhile Hungary being under Austrian rule, Bulgaria was under Ottoman empire rule. Bulgaria was ruled by Ottoman empire for 500 years but Hungary was under Ottoman empire rule for 158 years.

Answer Link

Otras preguntas

| (Type an integer, proper fraction, or mixed number.) I
Draw the best Lewis structure for CH3CH(CH3)CH2C(CH2CH3)2CHO, a neutral molecule. HELP PLEASE
Qu' est -ce qu'un espèce chimique
circle the equivalent expressions!! 1. 14z + 12x 2. 2 + (7z + 6x) 3. 2(7z + 6x) 4. 9x + 3(4z + x) + 2z
Ramon plans to sell his car and places an ad with x lines. The newspaper charges y dollars for the first g lines and p dollars per extra line to run the ad for
-9 + (-27x) please help
The measures of the angles of a triangle are shown in the figure below. Solve for x. (3x)° 58° 80°
Refer to the accompanying data set and use the 25 home voltage measurements to construct a frequency distribution with five classes. Begin with a lower class li
What are at least two questions that the field of human computer interaction is trying to address HELP PLEASE
 Write a paragraph explaining how the concept of total war affected the warring nations’ economies.