missstreamies missstreamies
  • 02-06-2020
  • Chemistry
contestada

How many atoms are in a casein molecule?

Respuesta :

turtlefishangel
turtlefishangel turtlefishangel
  • 02-06-2020
The heavy atom count of a casein molecule is 143 I believe
Answer Link

Otras preguntas

In 1901 Australia gain independence from Great Britain and formed a new democratic or auto credit
what is the answer to 5x-10=20 ?
What two core teaching strategies do you use to achieve your desired results
why did the breakup of the ottoman empire disrupt the balance of power in europe
If a cell is more concentrated than the solution it’s sitting in , it will eventually explode.This is called
Does the sentence state a fact or an opinion? Dish soap, olive oil, and water won't mix in a container because they each have a different density, or mass in a
A) co2 is non polar while h2o is polar why? b) why pcl5 is very reactive? c) h2o is a liquid h2s is a gas. why? It is a 3 mark question so (a) carries 1 mark, (
6. A metal forms two oxides, A and B. 1 g of A on reduction gave 0.881 g ofmetal, while 1 g of B yielded 0.788 g of metal. Show that these facts are inagreement
Please helppp !! What did the emancipation proclamation state? What had Lincoln hoped would happen when he issued his proclamation?
cosec(6b+pi/8)=sec(2b-pi/8)​